C27H23F5N2O2S — CID 19355192
4-(4-methylphenyl)-3-(4-methylsulfonylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1-(2-phenylethyl)pyrazole (PubChem CID 19355192) has the molecular formula C27H23F5N2O2S and a molecular weight of 534.55 g/mol. Its IUPAC name is 4-(4-methylphenyl)-3-(4-methylsulfonylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1-(2-phenylethyl)pyrazole.
| Compound Name | 4-(4-methylphenyl)-3-(4-methylsulfonylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1-(2-phenylethyl)pyrazole |
|---|---|
| PubChem CID | 19355192 |
| Molecular Formula | C27H23F5N2O2S |
| Molecular Weight | 534.55 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 4-(4-methylphenyl)-3-(4-methylsulfonylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1-(2-phenylethyl)pyrazole |
| SMILES | Cc1ccc(-c2c(-c3ccc(S(C)(=O)=O)cc3)nn(CCc3ccccc3)c2C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H23F5N2O2S/c1-18-8-10-20(11-9-18)23-24(21-12-14-22(15-13-21)37(2,35)36)33-34(17-16-19-6-4-3-5-7-19)25(23)26(28,29)27(30,31)32/h3-15H,16-17H2,1-2H3 |
| InChIKey | KYYHRJLWWWEEDN-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.55 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|