C19H23F3N2O2S — CID 19356017
4-cyclohexyl-1-ethyl-3-(4-methylsulfonylphenyl)-5-(trifluoromethyl)pyrazole (PubChem CID 19356017) has the molecular formula C19H23F3N2O2S and a molecular weight of 400.47 g/mol. Its IUPAC name is 4-cyclohexyl-1-ethyl-3-(4-methylsulfonylphenyl)-5-(trifluoromethyl)pyrazole.
| Compound Name | 4-cyclohexyl-1-ethyl-3-(4-methylsulfonylphenyl)-5-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 19356017 |
| Molecular Formula | C19H23F3N2O2S |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 4-cyclohexyl-1-ethyl-3-(4-methylsulfonylphenyl)-5-(trifluoromethyl)pyrazole |
| SMILES | CCn1nc(-c2ccc(S(C)(=O)=O)cc2)c(C2CCCCC2)c1C(F)(F)F |
| InChI | InChI=1S/C19H23F3N2O2S/c1-3-24-18(19(20,21)22)16(13-7-5-4-6-8-13)17(23-24)14-9-11-15(12-10-14)27(2,25)26/h9-13H,3-8H2,1-2H3 |
| InChIKey | LAPOSYHYXBLCNZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |