C22H18FN3OS — CID 20735827
4-[3-(4-fluorophenyl)-5-[(4-methylphenyl)methylsulfinyl]-1H-pyrazol-4-yl]pyridine (PubChem CID 20735827) has the molecular formula C22H18FN3OS and a molecular weight of 391.47 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-5-[(4-methylphenyl)methylsulfinyl]-1H-pyrazol-4-yl]pyridine.
| Compound Name | 4-[3-(4-fluorophenyl)-5-[(4-methylphenyl)methylsulfinyl]-1H-pyrazol-4-yl]pyridine |
|---|---|
| PubChem CID | 20735827 |
| Molecular Formula | C22H18FN3OS |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-5-[(4-methylphenyl)methylsulfinyl]-1H-pyrazol-4-yl]pyridine |
| SMILES | Cc1ccc(CS(=O)c2[nH]nc(-c3ccc(F)cc3)c2-c2ccncc2)cc1 |
| InChI | InChI=1S/C22H18FN3OS/c1-15-2-4-16(5-3-15)14-28(27)22-20(17-10-12-24-13-11-17)21(25-26-22)18-6-8-19(23)9-7-18/h2-13H,14H2,1H3,(H,25,26) |
| InChIKey | ZJHXUZHWJATVPR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |