C19H21FN4 — CID 22953900
4-[3-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-5-yl]-N-methylbutan-1-amine (PubChem CID 22953900) has the molecular formula C19H21FN4 and a molecular weight of 324.40 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-5-yl]-N-methylbutan-1-amine.
| Compound Name | 4-[3-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-5-yl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 22953900 |
| Molecular Formula | C19H21FN4 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-5-yl]-N-methylbutan-1-amine |
| SMILES | CNCCCCc1[nH]nc(-c2ccc(F)cc2)c1-c1ccncc1 |
| InChI | InChI=1S/C19H21FN4/c1-21-11-3-2-4-17-18(14-9-12-22-13-10-14)19(24-23-17)15-5-7-16(20)8-6-15/h5-10,12-13,21H,2-4,11H2,1H3,(H,23,24) |
| InChIKey | UUQNBUCKOMDNOK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|