C21H14F3N3S — CID 166490664
3-[4-[3-pyridin-4-yl-5-(trifluoromethyl)-1H-pyrazol-4-yl]phenyl]benzenethiol (PubChem CID 166490664) has the molecular formula C21H14F3N3S and a molecular weight of 397.43 g/mol. Its IUPAC name is 3-[4-[3-pyridin-4-yl-5-(trifluoromethyl)-1H-pyrazol-4-yl]phenyl]benzenethiol.
| Compound Name | 3-[4-[3-pyridin-4-yl-5-(trifluoromethyl)-1H-pyrazol-4-yl]phenyl]benzenethiol |
|---|---|
| PubChem CID | 166490664 |
| Molecular Formula | C21H14F3N3S |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 3-[4-[3-pyridin-4-yl-5-(trifluoromethyl)-1H-pyrazol-4-yl]phenyl]benzenethiol |
| SMILES | FC(F)(F)c1[nH]nc(-c2ccncc2)c1-c1ccc(-c2cccc(S)c2)cc1 |
| InChI | InChI=1S/C21H14F3N3S/c22-21(23,24)20-18(19(26-27-20)15-8-10-25-11-9-15)14-6-4-13(5-7-14)16-2-1-3-17(28)12-16/h1-12,28H,(H,26,27) |
| InChIKey | XEAVDANBFKBJQN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|