C15H12ClFN2O2 — CID 92757195
6-chloro-N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]pyridine-3-carboxamide (PubChem CID 92757195) has the molecular formula C15H12ClFN2O2 and a molecular weight of 306.72 g/mol. Its IUPAC name is 6-chloro-N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 92757195 |
| Molecular Formula | C15H12ClFN2O2 |
| Molecular Weight | 306.72 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 6-chloro-N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NC[C@@H]1Cc2cc(F)ccc2O1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C15H12ClFN2O2/c16-14-4-1-9(7-18-14)15(20)19-8-12-6-10-5-11(17)2-3-13(10)21-12/h1-5,7,12H,6,8H2,(H,19,20)/t12-/m0/s1 |
| InChIKey | YWGSOGRURNVAQB-LBPRGKRZSA-N |
| XLogP | 2.61 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.72 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|