About N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-methylbenzamide
N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-methylbenzamide (PubChem CID 92756956) has the molecular formula C17H16FNO2
and a molecular weight of 285.32 g/mol. Its IUPAC name is N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-methylbenzamide.
Molecular Properties
| Compound Name | N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-methylbenzamide |
| PubChem CID | 92756956 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NC[C@@H]1Cc2cc(F)ccc2O1 |
| InChI | InChI=1S/C17H16FNO2/c1-11-4-2-3-5-15(11)17(20)19-10-14-9-12-8-13(18)6-7-16(12)21-14/h2-8,14H,9-10H2,1H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | AHZUNZSMYKPCMU-AWEZNQCLSA-N |
| XLogP | 2.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-methylbenzamide?
The IUPAC name of N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-methylbenzamide (CID 92756956) is N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-methylbenzamide.
What is the SMILES notation for N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-methylbenzamide?
The canonical SMILES for N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-methylbenzamide is Cc1ccccc1C(=O)NC[C@@H]1Cc2cc(F)ccc2O1.
What is the InChIKey of N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-methylbenzamide?
The InChIKey is AHZUNZSMYKPCMU-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H16FNO2/c1-11-4-2-3-5-15(11)17(20)19-10-14-9-12-8-13(18)6-7-16(12)21-14/h2-8,14H,9-10H2,1H3,(H,19,20)/t14-/m0/s1.
What are the key properties of N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-methylbenzamide?
N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-methylbenzamide has a molecular weight of 285.32 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-methylbenzamide is sourced from PubChem (CID 92756956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).