C14H10FN3O3S — CID 174680307
[6-[5-(4-fluorophenyl)-1,3-oxazol-4-yl]pyridazin-3-yl]methanesulfinic acid (PubChem CID 174680307) has the molecular formula C14H10FN3O3S and a molecular weight of 319.32 g/mol. Its IUPAC name is [6-[5-(4-fluorophenyl)-1,3-oxazol-4-yl]pyridazin-3-yl]methanesulfinic acid.
| Compound Name | [6-[5-(4-fluorophenyl)-1,3-oxazol-4-yl]pyridazin-3-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 174680307 |
| Molecular Formula | C14H10FN3O3S |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | [6-[5-(4-fluorophenyl)-1,3-oxazol-4-yl]pyridazin-3-yl]methanesulfinic acid |
| SMILES | O=S(O)Cc1ccc(-c2ncoc2-c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C14H10FN3O3S/c15-10-3-1-9(2-4-10)14-13(16-8-21-14)12-6-5-11(17-18-12)7-22(19)20/h1-6,8H,7H2,(H,19,20) |
| InChIKey | JCVZLMLVEHSGFQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|