C20H19FN2O2 — CID 51492681
5-(4-fluorophenyl)-N-[(2S)-4-phenylbutan-2-yl]-1,3-oxazole-4-carboxamide (PubChem CID 51492681) has the molecular formula C20H19FN2O2 and a molecular weight of 338.38 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[(2S)-4-phenylbutan-2-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-[(2S)-4-phenylbutan-2-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 51492681 |
| Molecular Formula | C20H19FN2O2 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[(2S)-4-phenylbutan-2-yl]-1,3-oxazole-4-carboxamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)c1ncoc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H19FN2O2/c1-14(7-8-15-5-3-2-4-6-15)23-20(24)18-19(25-13-22-18)16-9-11-17(21)12-10-16/h2-6,9-14H,7-8H2,1H3,(H,23,24)/t14-/m0/s1 |
| InChIKey | UEPQBYCJFCOKGV-AWEZNQCLSA-N |
| XLogP | 4.23 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |