C15H18N4O — CID 30138259
3-amino-N-[(2R)-4-phenylbutan-2-yl]pyrazine-2-carboxamide (PubChem CID 30138259) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 3-amino-N-[(2R)-4-phenylbutan-2-yl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[(2R)-4-phenylbutan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 30138259 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 3-amino-N-[(2R)-4-phenylbutan-2-yl]pyrazine-2-carboxamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)c1nccnc1N |
| InChI | InChI=1S/C15H18N4O/c1-11(7-8-12-5-3-2-4-6-12)19-15(20)13-14(16)18-10-9-17-13/h2-6,9-11H,7-8H2,1H3,(H2,16,18)(H,19,20)/t11-/m1/s1 |
| InChIKey | YESLPWZLHGLIAF-LLVKDONJSA-N |
| XLogP | 1.81 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |