C16H18N4O3 — CID 120546825
4-[(3-aminopyrazine-2-carbonyl)amino]-5-phenylpentanoic acid (PubChem CID 120546825) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is 4-[(3-aminopyrazine-2-carbonyl)amino]-5-phenylpentanoic acid.
| Compound Name | 4-[(3-aminopyrazine-2-carbonyl)amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 120546825 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 4-[(3-aminopyrazine-2-carbonyl)amino]-5-phenylpentanoic acid |
| SMILES | Nc1nccnc1C(=O)NC(CCC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C16H18N4O3/c17-15-14(18-8-9-19-15)16(23)20-12(6-7-13(21)22)10-11-4-2-1-3-5-11/h1-5,8-9,12H,6-7,10H2,(H2,17,19)(H,20,23)(H,21,22) |
| InChIKey | OSVUTEMDNZAZQG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |