C26H23FN2O2 — CID 100506520
2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(2R)-4-phenylbutan-2-yl]benzamide (PubChem CID 100506520) has the molecular formula C26H23FN2O2 and a molecular weight of 414.48 g/mol. Its IUPAC name is 2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(2R)-4-phenylbutan-2-yl]benzamide.
| Compound Name | 2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(2R)-4-phenylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 100506520 |
| Molecular Formula | C26H23FN2O2 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(2R)-4-phenylbutan-2-yl]benzamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)c1ccccc1-c1ncc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C26H23FN2O2/c1-18(11-12-19-7-3-2-4-8-19)29-25(30)22-9-5-6-10-23(22)26-28-17-24(31-26)20-13-15-21(27)16-14-20/h2-10,13-18H,11-12H2,1H3,(H,29,30)/t18-/m1/s1 |
| InChIKey | ARKAPTBXAVVGCU-GOSISDBHSA-N |
| XLogP | 5.90 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |