C22H16FN3O4 — CID 36702942
N'-[2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]benzoyl]-2-methylfuran-3-carbohydrazide (PubChem CID 36702942) has the molecular formula C22H16FN3O4 and a molecular weight of 405.39 g/mol. Its IUPAC name is N'-[2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]benzoyl]-2-methylfuran-3-carbohydrazide.
| Compound Name | N'-[2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]benzoyl]-2-methylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 36702942 |
| Molecular Formula | C22H16FN3O4 |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N'-[2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]benzoyl]-2-methylfuran-3-carbohydrazide |
| SMILES | Cc1occc1C(=O)NNC(=O)c1ccccc1-c1ncc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C22H16FN3O4/c1-13-16(10-11-29-13)20(27)25-26-21(28)17-4-2-3-5-18(17)22-24-12-19(30-22)14-6-8-15(23)9-7-14/h2-12H,1H3,(H,25,27)(H,26,28) |
| InChIKey | BEMQLNJUHIPJPE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|