C23H16FN3O4 — CID 36762830
2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N'-(2-hydroxybenzoyl)benzohydrazide (PubChem CID 36762830) has the molecular formula C23H16FN3O4 and a molecular weight of 417.40 g/mol. Its IUPAC name is 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N'-(2-hydroxybenzoyl)benzohydrazide.
| Compound Name | 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N'-(2-hydroxybenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 36762830 |
| Molecular Formula | C23H16FN3O4 |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N'-(2-hydroxybenzoyl)benzohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1-c1ncc(-c2ccccc2F)o1)c1ccccc1O |
| InChI | InChI=1S/C23H16FN3O4/c24-18-11-5-3-9-16(18)20-13-25-23(31-20)15-8-2-1-7-14(15)21(29)26-27-22(30)17-10-4-6-12-19(17)28/h1-13,28H,(H,26,29)(H,27,30) |
| InChIKey | OSFVMVFATKTJKU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|