C21H19FN2O4 — CID 36654951
methyl 4-[[2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoyl]amino]butanoate (PubChem CID 36654951) has the molecular formula C21H19FN2O4 and a molecular weight of 382.39 g/mol. Its IUPAC name is methyl 4-[[2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 36654951 |
| Molecular Formula | C21H19FN2O4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | methyl 4-[[2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1ccccc1-c1ncc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C21H19FN2O4/c1-27-19(25)11-6-12-23-20(26)14-7-2-3-8-15(14)21-24-13-18(28-21)16-9-4-5-10-17(16)22/h2-5,7-10,13H,6,11-12H2,1H3,(H,23,26) |
| InChIKey | UFMAQYKXDDBCSJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|