C23H25FN2O3 — CID 36807682
N-(3-butoxypropyl)-2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzamide (PubChem CID 36807682) has the molecular formula C23H25FN2O3 and a molecular weight of 396.46 g/mol. Its IUPAC name is N-(3-butoxypropyl)-2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzamide.
| Compound Name | N-(3-butoxypropyl)-2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzamide |
|---|---|
| PubChem CID | 36807682 |
| Molecular Formula | C23H25FN2O3 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-(3-butoxypropyl)-2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzamide |
| SMILES | CCCCOCCCNC(=O)c1ccccc1-c1ncc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C23H25FN2O3/c1-2-3-14-28-15-8-13-25-22(27)17-9-4-5-10-18(17)23-26-16-21(29-23)19-11-6-7-12-20(19)24/h4-7,9-12,16H,2-3,8,13-15H2,1H3,(H,25,27) |
| InChIKey | ZPUDKUYCXFKWDJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|