C20H19FN2O2 — CID 42945534
N-butan-2-yl-2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzamide (PubChem CID 42945534) has the molecular formula C20H19FN2O2 and a molecular weight of 338.38 g/mol. Its IUPAC name is N-butan-2-yl-2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzamide.
| Compound Name | N-butan-2-yl-2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzamide |
|---|---|
| PubChem CID | 42945534 |
| Molecular Formula | C20H19FN2O2 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-butan-2-yl-2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzamide |
| SMILES | CCC(C)NC(=O)c1ccccc1-c1ncc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C20H19FN2O2/c1-3-13(2)23-19(24)14-8-4-5-9-15(14)20-22-12-18(25-20)16-10-6-7-11-17(16)21/h4-13H,3H2,1-2H3,(H,23,24) |
| InChIKey | AXBIWEJLRJTPRP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |