C21H21FN2O2 — CID 36744321
2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(3-methylbutyl)benzamide (PubChem CID 36744321) has the molecular formula C21H21FN2O2 and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(3-methylbutyl)benzamide.
| Compound Name | 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 36744321 |
| Molecular Formula | C21H21FN2O2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(3-methylbutyl)benzamide |
| SMILES | CC(C)CCNC(=O)c1ccccc1-c1ncc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C21H21FN2O2/c1-14(2)11-12-23-20(25)15-7-3-4-8-16(15)21-24-13-19(26-21)17-9-5-6-10-18(17)22/h3-10,13-14H,11-12H2,1-2H3,(H,23,25) |
| InChIKey | PVYXCWAFDLBURE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |