C19H17FN2O3 — CID 36656774
2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)benzamide (PubChem CID 36656774) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 36656774 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccccc1-c1ncc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C19H17FN2O3/c1-24-11-10-21-18(23)13-6-2-3-7-14(13)19-22-12-17(25-19)15-8-4-5-9-16(15)20/h2-9,12H,10-11H2,1H3,(H,21,23) |
| InChIKey | XGOWAZPYXHXQAJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|