C22H22FN3O2 — CID 119461006
2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(piperidin-3-ylmethyl)benzamide (PubChem CID 119461006) has the molecular formula C22H22FN3O2 and a molecular weight of 379.44 g/mol. Its IUPAC name is 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(piperidin-3-ylmethyl)benzamide.
| Compound Name | 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(piperidin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 119461006 |
| Molecular Formula | C22H22FN3O2 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(piperidin-3-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCCNC1)c1ccccc1-c1ncc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C22H22FN3O2/c23-19-10-4-3-9-18(19)20-14-26-22(28-20)17-8-2-1-7-16(17)21(27)25-13-15-6-5-11-24-12-15/h1-4,7-10,14-15,24H,5-6,11-13H2,(H,25,27) |
| InChIKey | GPWMWDUYGVCNSK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |