C21H18FNO4 — CID 97014554
[(2R)-oxolan-2-yl]methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate (PubChem CID 97014554) has the molecular formula C21H18FNO4 and a molecular weight of 367.38 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate.
| Compound Name | [(2R)-oxolan-2-yl]methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate |
|---|---|
| PubChem CID | 97014554 |
| Molecular Formula | C21H18FNO4 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate |
| SMILES | O=C(OC[C@H]1CCCO1)c1ccccc1-c1ncc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C21H18FNO4/c22-18-10-4-3-9-17(18)19-12-23-20(27-19)15-7-1-2-8-16(15)21(24)26-13-14-6-5-11-25-14/h1-4,7-10,12,14H,5-6,11,13H2/t14-/m1/s1 |
| InChIKey | DJFUUMQNPOLEOB-CQSZACIVSA-N |
| XLogP | 4.48 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |