C15H10FN3O2 — CID 139006704
5-(4-fluorophenyl)-N-pyridin-4-yl-1,3-oxazole-4-carboxamide (PubChem CID 139006704) has the molecular formula C15H10FN3O2 and a molecular weight of 283.26 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-pyridin-4-yl-1,3-oxazole-4-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-pyridin-4-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 139006704 |
| Molecular Formula | C15H10FN3O2 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 5-(4-fluorophenyl)-N-pyridin-4-yl-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1ccncc1)c1ncoc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C15H10FN3O2/c16-11-3-1-10(2-4-11)14-13(18-9-21-14)15(20)19-12-5-7-17-8-6-12/h1-9H,(H,17,19,20) |
| InChIKey | HGFPEXWMLLCRJG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |