C22H16FNO3S2 — CID 174374750
[4-(6-fluoro-4-methanethioyl-3-pyridin-3-yl-4H-chromen-2-yl)phenyl]methanesulfinic acid (PubChem CID 174374750) has the molecular formula C22H16FNO3S2 and a molecular weight of 425.51 g/mol. Its IUPAC name is [4-(6-fluoro-4-methanethioyl-3-pyridin-3-yl-4H-chromen-2-yl)phenyl]methanesulfinic acid.
| Compound Name | [4-(6-fluoro-4-methanethioyl-3-pyridin-3-yl-4H-chromen-2-yl)phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174374750 |
| Molecular Formula | C22H16FNO3S2 |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | [4-(6-fluoro-4-methanethioyl-3-pyridin-3-yl-4H-chromen-2-yl)phenyl]methanesulfinic acid |
| SMILES | O=S(O)Cc1ccc(C2=C(c3cccnc3)C(C=S)c3cc(F)ccc3O2)cc1 |
| InChI | InChI=1S/C22H16FNO3S2/c23-17-7-8-20-18(10-17)19(12-28)21(16-2-1-9-24-11-16)22(27-20)15-5-3-14(4-6-15)13-29(25)26/h1-12,19H,13H2,(H,25,26) |
| InChIKey | JFZZHAFOQQVJJH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|