C18H14F2N4OS — CID 76572118
1-[[5-(2,5-difluorophenyl)furan-2-yl]methylideneamino]-3-(pyridin-3-ylmethyl)thiourea (PubChem CID 76572118) has the molecular formula C18H14F2N4OS and a molecular weight of 372.40 g/mol. Its IUPAC name is 1-[[5-(2,5-difluorophenyl)furan-2-yl]methylideneamino]-3-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[[5-(2,5-difluorophenyl)furan-2-yl]methylideneamino]-3-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 76572118 |
| Molecular Formula | C18H14F2N4OS |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 1-[[5-(2,5-difluorophenyl)furan-2-yl]methylideneamino]-3-(pyridin-3-ylmethyl)thiourea |
| SMILES | Fc1ccc(F)c(-c2ccc(C=NNC(=S)NCc3cccnc3)o2)c1 |
| InChI | InChI=1S/C18H14F2N4OS/c19-13-3-5-16(20)15(8-13)17-6-4-14(25-17)11-23-24-18(26)22-10-12-2-1-7-21-9-12/h1-9,11H,10H2,(H2,22,24,26) |
| InChIKey | UHJVJHWBCMKYMY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|