C20H15Cl2N3O2S — CID 22779611
(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(pyridin-3-ylmethylcarbamothioyl)prop-2-enamide (PubChem CID 22779611) has the molecular formula C20H15Cl2N3O2S and a molecular weight of 432.33 g/mol. Its IUPAC name is (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(pyridin-3-ylmethylcarbamothioyl)prop-2-enamide.
| Compound Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(pyridin-3-ylmethylcarbamothioyl)prop-2-enamide |
|---|---|
| PubChem CID | 22779611 |
| Molecular Formula | C20H15Cl2N3O2S |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(pyridin-3-ylmethylcarbamothioyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(Cl)cc2Cl)o1)NC(=S)NCc1cccnc1 |
| InChI | InChI=1S/C20H15Cl2N3O2S/c21-14-3-6-16(17(22)10-14)18-7-4-15(27-18)5-8-19(26)25-20(28)24-12-13-2-1-9-23-11-13/h1-11H,12H2,(H2,24,25,26,28)/b8-5+ |
| InChIKey | FKQLPYNFQKIPNP-VMPITWQZSA-N |
| XLogP | 4.85 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|