C31H25Cl2N3O3S — CID 17315148
(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]prop-2-enamide (PubChem CID 17315148) has the molecular formula C31H25Cl2N3O3S and a molecular weight of 590.53 g/mol. Its IUPAC name is (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17315148 |
| Molecular Formula | C31H25Cl2N3O3S |
| Molecular Weight | 590.53 g/mol |
| Exact Mass | 589.10 |
| IUPAC Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]prop-2-enamide |
| SMILES | CC(C)c1ccc2oc(-c3ccc(CNC(=S)NC(=O)/C=C/c4ccc(-c5ccc(Cl)cc5Cl)o4)cc3)nc2c1 |
| InChI | InChI=1S/C31H25Cl2N3O3S/c1-18(2)21-7-12-28-26(15-21)35-30(39-28)20-5-3-19(4-6-20)17-34-31(40)36-29(37)14-10-23-9-13-27(38-23)24-11-8-22(32)16-25(24)33/h3-16,18H,17H2,1-2H3,(H2,34,36,37,40)/b14-10+ |
| InChIKey | WHTNNAXQJRKKBB-GXDHUFHOSA-N |
| XLogP | 8.39 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.53 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|