C23H21N3O3S — CID 2979560
N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]furan-2-carboxamide (PubChem CID 2979560) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]furan-2-carboxamide.
| Compound Name | N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2979560 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]furan-2-carboxamide |
| SMILES | CC(C)c1ccc2oc(-c3ccc(CNC(=S)NC(=O)c4ccco4)cc3)nc2c1 |
| InChI | InChI=1S/C23H21N3O3S/c1-14(2)17-9-10-19-18(12-17)25-22(29-19)16-7-5-15(6-8-16)13-24-23(30)26-21(27)20-4-3-11-28-20/h3-12,14H,13H2,1-2H3,(H2,24,26,27,30) |
| InChIKey | XQPPJDBENLTCJQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|