C24H20F3NO3S — CID 70338136
[4-[5-oxo-4-phenyl-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]phenyl]methanesulfinic acid (PubChem CID 70338136) has the molecular formula C24H20F3NO3S and a molecular weight of 459.49 g/mol. Its IUPAC name is [4-[5-oxo-4-phenyl-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[5-oxo-4-phenyl-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 70338136 |
| Molecular Formula | C24H20F3NO3S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | [4-[5-oxo-4-phenyl-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]phenyl]methanesulfinic acid |
| SMILES | O=C1C(c2ccccc2)C(c2ccc(CS(=O)O)cc2)CN1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H20F3NO3S/c25-24(26,27)19-10-12-20(13-11-19)28-14-21(17-8-6-16(7-9-17)15-32(30)31)22(23(28)29)18-4-2-1-3-5-18/h1-13,21-22H,14-15H2,(H,30,31) |
| InChIKey | LYXVXEUBYIKUJU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|