C23H22F3NO2 — CID 153062373
(3S,4S)-3-[2-(2-cyclopropylphenyl)acetyl]-1-methyl-4-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 153062373) has the molecular formula C23H22F3NO2 and a molecular weight of 401.43 g/mol. Its IUPAC name is (3S,4S)-3-[2-(2-cyclopropylphenyl)acetyl]-1-methyl-4-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | (3S,4S)-3-[2-(2-cyclopropylphenyl)acetyl]-1-methyl-4-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 153062373 |
| Molecular Formula | C23H22F3NO2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (3S,4S)-3-[2-(2-cyclopropylphenyl)acetyl]-1-methyl-4-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | CN1C[C@H](c2ccc(C(F)(F)F)cc2)[C@@H](C(=O)Cc2ccccc2C2CC2)C1=O |
| InChI | InChI=1S/C23H22F3NO2/c1-27-13-19(15-8-10-17(11-9-15)23(24,25)26)21(22(27)29)20(28)12-16-4-2-3-5-18(16)14-6-7-14/h2-5,8-11,14,19,21H,6-7,12-13H2,1H3/t19-,21+/m1/s1 |
| InChIKey | VJRUITQSYNFENE-CTNGQTDRSA-N |
| XLogP | 4.57 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|