C18H12F7N3O2 — CID 134412376
(3R,4R)-1-methyl-2-oxo-N-(2,3,5,6-tetrafluoro-4-pyridinyl)-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 134412376) has the molecular formula C18H12F7N3O2 and a molecular weight of 435.30 g/mol. Its IUPAC name is (3R,4R)-1-methyl-2-oxo-N-(2,3,5,6-tetrafluoro-4-pyridinyl)-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-1-methyl-2-oxo-N-(2,3,5,6-tetrafluoro-4-pyridinyl)-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134412376 |
| Molecular Formula | C18H12F7N3O2 |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | (3R,4R)-1-methyl-2-oxo-N-(2,3,5,6-tetrafluoro-4-pyridinyl)-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | CN1C[C@@H](c2ccc(C(F)(F)F)cc2)[C@H](C(=O)Nc2c(F)c(F)nc(F)c2F)C1=O |
| InChI | InChI=1S/C18H12F7N3O2/c1-28-6-9(7-2-4-8(5-3-7)18(23,24)25)10(17(28)30)16(29)26-13-11(19)14(21)27-15(22)12(13)20/h2-5,9-10H,6H2,1H3,(H,26,27,29)/t9-,10+/m0/s1 |
| InChIKey | RETVWMIHSIXYIA-VHSXEESVSA-N |
| XLogP | 3.47 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|