C19H18F3N3O2 — CID 134412449
(3R,4R)-1-methyl-N-(2-methyl-4-pyridinyl)-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 134412449) has the molecular formula C19H18F3N3O2 and a molecular weight of 377.37 g/mol. Its IUPAC name is (3R,4R)-1-methyl-N-(2-methyl-4-pyridinyl)-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-1-methyl-N-(2-methyl-4-pyridinyl)-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134412449 |
| Molecular Formula | C19H18F3N3O2 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (3R,4R)-1-methyl-N-(2-methyl-4-pyridinyl)-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | Cc1cc(NC(=O)[C@@H]2C(=O)N(C)C[C@H]2c2ccc(C(F)(F)F)cc2)ccn1 |
| InChI | InChI=1S/C19H18F3N3O2/c1-11-9-14(7-8-23-11)24-17(26)16-15(10-25(2)18(16)27)12-3-5-13(6-4-12)19(20,21)22/h3-9,15-16H,10H2,1-2H3,(H,23,24,26)/t15-,16+/m0/s1 |
| InChIKey | GPFFCXGDFDHEQZ-JKSUJKDBSA-N |
| XLogP | 3.22 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|