C17H15F3N4O3 — CID 134412469
(3R,4R)-1-methyl-2-oxo-N-(6-oxo-1H-pyrimidin-2-yl)-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 134412469) has the molecular formula C17H15F3N4O3 and a molecular weight of 380.33 g/mol. Its IUPAC name is (3R,4R)-1-methyl-2-oxo-N-(6-oxo-1H-pyrimidin-2-yl)-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-1-methyl-2-oxo-N-(6-oxo-1H-pyrimidin-2-yl)-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134412469 |
| Molecular Formula | C17H15F3N4O3 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (3R,4R)-1-methyl-2-oxo-N-(6-oxo-1H-pyrimidin-2-yl)-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | CN1C[C@@H](c2ccc(C(F)(F)F)cc2)[C@H](C(=O)Nc2nccc(=O)[nH]2)C1=O |
| InChI | InChI=1S/C17H15F3N4O3/c1-24-8-11(9-2-4-10(5-3-9)17(18,19)20)13(15(24)27)14(26)23-16-21-7-6-12(25)22-16/h2-7,11,13H,8H2,1H3,(H2,21,22,23,25,26)/t11-,13+/m0/s1 |
| InChIKey | ZCYDGZYAAJVFPI-WCQYABFASA-N |
| XLogP | 1.60 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|