C19H15F6N3O2 — CID 134412480
(3R,4R)-1-methyl-2-oxo-4-[4-(trifluoromethyl)phenyl]-N-[2-(trifluoromethyl)-4-pyridinyl]pyrrolidine-3-carboxamide (PubChem CID 134412480) has the molecular formula C19H15F6N3O2 and a molecular weight of 431.34 g/mol. Its IUPAC name is (3R,4R)-1-methyl-2-oxo-4-[4-(trifluoromethyl)phenyl]-N-[2-(trifluoromethyl)-4-pyridinyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-1-methyl-2-oxo-4-[4-(trifluoromethyl)phenyl]-N-[2-(trifluoromethyl)-4-pyridinyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134412480 |
| Molecular Formula | C19H15F6N3O2 |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | (3R,4R)-1-methyl-2-oxo-4-[4-(trifluoromethyl)phenyl]-N-[2-(trifluoromethyl)-4-pyridinyl]pyrrolidine-3-carboxamide |
| SMILES | CN1C[C@@H](c2ccc(C(F)(F)F)cc2)[C@H](C(=O)Nc2ccnc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C19H15F6N3O2/c1-28-9-13(10-2-4-11(5-3-10)18(20,21)22)15(17(28)30)16(29)27-12-6-7-26-14(8-12)19(23,24)25/h2-8,13,15H,9H2,1H3,(H,26,27,29)/t13-,15+/m0/s1 |
| InChIKey | QVAQDCALZOZXKJ-DZGCQCFKSA-N |
| XLogP | 3.93 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|