C18H14Cl2F3N3O2 — CID 134412359
(3R,4R)-N-(2,3-dichloro-4-pyridinyl)-1-methyl-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 134412359) has the molecular formula C18H14Cl2F3N3O2 and a molecular weight of 432.23 g/mol. Its IUPAC name is (3R,4R)-N-(2,3-dichloro-4-pyridinyl)-1-methyl-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-N-(2,3-dichloro-4-pyridinyl)-1-methyl-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134412359 |
| Molecular Formula | C18H14Cl2F3N3O2 |
| Molecular Weight | 432.23 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | (3R,4R)-N-(2,3-dichloro-4-pyridinyl)-1-methyl-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | CN1C[C@@H](c2ccc(C(F)(F)F)cc2)[C@H](C(=O)Nc2ccnc(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C18H14Cl2F3N3O2/c1-26-8-11(9-2-4-10(5-3-9)18(21,22)23)13(17(26)28)16(27)25-12-6-7-24-15(20)14(12)19/h2-7,11,13H,8H2,1H3,(H,24,25,27)/t11-,13+/m0/s1 |
| InChIKey | ORJFCJXHRURFHA-WCQYABFASA-N |
| XLogP | 4.22 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|