C20H18ClF3N2O4S — CID 134412502
(3S,4S)-N-(3-chloro-2-methylsulfonylphenyl)-1-methyl-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 134412502) has the molecular formula C20H18ClF3N2O4S and a molecular weight of 474.89 g/mol. Its IUPAC name is (3S,4S)-N-(3-chloro-2-methylsulfonylphenyl)-1-methyl-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-N-(3-chloro-2-methylsulfonylphenyl)-1-methyl-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134412502 |
| Molecular Formula | C20H18ClF3N2O4S |
| Molecular Weight | 474.89 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | (3S,4S)-N-(3-chloro-2-methylsulfonylphenyl)-1-methyl-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | CN1C[C@H](c2ccc(C(F)(F)F)cc2)[C@@H](C(=O)Nc2cccc(Cl)c2S(C)(=O)=O)C1=O |
| InChI | InChI=1S/C20H18ClF3N2O4S/c1-26-10-13(11-6-8-12(9-7-11)20(22,23)24)16(19(26)28)18(27)25-15-5-3-4-14(21)17(15)31(2,29)30/h3-9,13,16H,10H2,1-2H3,(H,25,27)/t13-,16+/m1/s1 |
| InChIKey | GGAPRIMMEIAPEZ-CJNGLKHVSA-N |
| XLogP | 3.57 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.89 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|