C18H14F2NO2S- — CID 174433339
[4-[5-fluoro-1-(4-fluorophenyl)-4-methylpyrrol-2-yl]phenyl]methanesulfinate (PubChem CID 174433339) has the molecular formula C18H14F2NO2S- and a molecular weight of 346.38 g/mol. Its IUPAC name is [4-[5-fluoro-1-(4-fluorophenyl)-4-methylpyrrol-2-yl]phenyl]methanesulfinate.
| Compound Name | [4-[5-fluoro-1-(4-fluorophenyl)-4-methylpyrrol-2-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174433339 |
| Molecular Formula | C18H14F2NO2S- |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | [4-[5-fluoro-1-(4-fluorophenyl)-4-methylpyrrol-2-yl]phenyl]methanesulfinate |
| SMILES | Cc1cc(-c2ccc(CS(=O)[O-])cc2)n(-c2ccc(F)cc2)c1F |
| InChI | InChI=1S/C18H15F2NO2S/c1-12-10-17(14-4-2-13(3-5-14)11-24(22)23)21(18(12)20)16-8-6-15(19)7-9-16/h2-10H,11H2,1H3,(H,22,23)/p-1 |
| InChIKey | BBTRXHOWBDTAIL-UHFFFAOYSA-M |
| XLogP | 4.11 |
| TPSA | 45.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|