C22H17FN2O3S2 — CID 10297026
4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(3-methylthiophen-2-yl)pyridazin-3-one (PubChem CID 10297026) has the molecular formula C22H17FN2O3S2 and a molecular weight of 440.52 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(3-methylthiophen-2-yl)pyridazin-3-one.
| Compound Name | 4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(3-methylthiophen-2-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 10297026 |
| Molecular Formula | C22H17FN2O3S2 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(3-methylthiophen-2-yl)pyridazin-3-one |
| SMILES | Cc1ccsc1-n1ncc(-c2ccc(S(C)(=O)=O)cc2)c(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C22H17FN2O3S2/c1-14-11-12-29-22(14)25-21(26)20(16-3-7-17(23)8-4-16)19(13-24-25)15-5-9-18(10-6-15)30(2,27)28/h3-13H,1-2H3 |
| InChIKey | GUHBBGPXLZOYSE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |