C25H19FN2O3S — CID 174386856
4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(2-phenylethenyl)pyridazin-3-one (PubChem CID 174386856) has the molecular formula C25H19FN2O3S and a molecular weight of 446.50 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(2-phenylethenyl)pyridazin-3-one.
| Compound Name | 4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(2-phenylethenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 174386856 |
| Molecular Formula | C25H19FN2O3S |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(2-phenylethenyl)pyridazin-3-one |
| SMILES | CS(=O)(=O)c1ccc(-c2cnn(C=Cc3ccccc3)c(=O)c2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H19FN2O3S/c1-32(30,31)22-13-9-19(10-14-22)23-17-27-28(16-15-18-5-3-2-4-6-18)25(29)24(23)20-7-11-21(26)12-8-20/h2-17H,1H3 |
| InChIKey | KNHWVKQECPRZIE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |