C23H22ClN2O4S- — CID 174387955
[4-[1-(3-chlorophenyl)-5-cyclohexyloxy-6-oxopyridazin-4-yl]phenyl]methanesulfinate (PubChem CID 174387955) has the molecular formula C23H22ClN2O4S- and a molecular weight of 457.96 g/mol. Its IUPAC name is [4-[1-(3-chlorophenyl)-5-cyclohexyloxy-6-oxopyridazin-4-yl]phenyl]methanesulfinate.
| Compound Name | [4-[1-(3-chlorophenyl)-5-cyclohexyloxy-6-oxopyridazin-4-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174387955 |
| Molecular Formula | C23H22ClN2O4S- |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | [4-[1-(3-chlorophenyl)-5-cyclohexyloxy-6-oxopyridazin-4-yl]phenyl]methanesulfinate |
| SMILES | O=c1c(OC2CCCCC2)c(-c2ccc(CS(=O)[O-])cc2)cnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H23ClN2O4S/c24-18-5-4-6-19(13-18)26-23(27)22(30-20-7-2-1-3-8-20)21(14-25-26)17-11-9-16(10-12-17)15-31(28)29/h4-6,9-14,20H,1-3,7-8,15H2,(H,28,29)/p-1 |
| InChIKey | ZWUQPUNUYUWTKD-UHFFFAOYSA-M |
| XLogP | 4.64 |
| TPSA | 84.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|