C24H18ClFN2O3S — CID 174376323
[4-[1-(3-chlorophenyl)-5-[(3-fluorophenyl)methyl]-6-oxopyridazin-4-yl]phenyl]methanesulfinic acid (PubChem CID 174376323) has the molecular formula C24H18ClFN2O3S and a molecular weight of 468.94 g/mol. Its IUPAC name is [4-[1-(3-chlorophenyl)-5-[(3-fluorophenyl)methyl]-6-oxopyridazin-4-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[1-(3-chlorophenyl)-5-[(3-fluorophenyl)methyl]-6-oxopyridazin-4-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174376323 |
| Molecular Formula | C24H18ClFN2O3S |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | [4-[1-(3-chlorophenyl)-5-[(3-fluorophenyl)methyl]-6-oxopyridazin-4-yl]phenyl]methanesulfinic acid |
| SMILES | O=c1c(Cc2cccc(F)c2)c(-c2ccc(CS(=O)O)cc2)cnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H18ClFN2O3S/c25-19-4-2-6-21(13-19)28-24(29)22(12-17-3-1-5-20(26)11-17)23(14-27-28)18-9-7-16(8-10-18)15-32(30)31/h1-11,13-14H,12,15H2,(H,30,31) |
| InChIKey | DTWNWDLKFNSTNG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|