C21H22ClN3O4S — CID 174375448
4-[1-(3-chlorophenyl)-6-oxo-5-pentoxypyridazin-4-yl]benzenesulfonamide (PubChem CID 174375448) has the molecular formula C21H22ClN3O4S and a molecular weight of 447.94 g/mol. Its IUPAC name is 4-[1-(3-chlorophenyl)-6-oxo-5-pentoxypyridazin-4-yl]benzenesulfonamide.
| Compound Name | 4-[1-(3-chlorophenyl)-6-oxo-5-pentoxypyridazin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 174375448 |
| Molecular Formula | C21H22ClN3O4S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 4-[1-(3-chlorophenyl)-6-oxo-5-pentoxypyridazin-4-yl]benzenesulfonamide |
| SMILES | CCCCCOc1c(-c2ccc(S(N)(=O)=O)cc2)cnn(-c2cccc(Cl)c2)c1=O |
| InChI | InChI=1S/C21H22ClN3O4S/c1-2-3-4-12-29-20-19(15-8-10-18(11-9-15)30(23,27)28)14-24-25(21(20)26)17-7-5-6-16(22)13-17/h5-11,13-14H,2-4,12H2,1H3,(H2,23,27,28) |
| InChIKey | LFNQNLZZGGFXGW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|