C10H10FN — CID 18613806
7-fluoro-1-methyl-3,4-dihydroisoquinoline (PubChem CID 18613806) has the molecular formula C10H10FN and a molecular weight of 163.19 g/mol. Its IUPAC name is 7-fluoro-1-methyl-3,4-dihydroisoquinoline.
| Compound Name | 7-fluoro-1-methyl-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 18613806 |
| Molecular Formula | C10H10FN |
| Molecular Weight | 163.19 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 7-fluoro-1-methyl-3,4-dihydroisoquinoline |
| SMILES | CC1=NCCc2ccc(F)cc21 |
| InChI | InChI=1S/C10H10FN/c1-7-10-6-9(11)3-2-8(10)4-5-12-7/h2-3,6H,4-5H2,1H3 |
| InChIKey | XGMULTGNKKXZBS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |