C11H13FN2 — CID 126982364
2-(5-fluoro-2-methylphenyl)-1,4,5,6-tetrahydropyrimidine (PubChem CID 126982364) has the molecular formula C11H13FN2 and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-(5-fluoro-2-methylphenyl)-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-(5-fluoro-2-methylphenyl)-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 126982364 |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 2-(5-fluoro-2-methylphenyl)-1,4,5,6-tetrahydropyrimidine |
| SMILES | Cc1ccc(F)cc1C1=NCCCN1 |
| InChI | InChI=1S/C11H13FN2/c1-8-3-4-9(12)7-10(8)11-13-5-2-6-14-11/h3-4,7H,2,5-6H2,1H3,(H,13,14) |
| InChIKey | UHYBWSSYFWLNAN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |