C11H14N2O — CID 137209925
5-methyl-2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenol (PubChem CID 137209925) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-methyl-2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenol.
| Compound Name | 5-methyl-2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenol |
|---|---|
| PubChem CID | 137209925 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 5-methyl-2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenol |
| SMILES | Cc1ccc(C2=NCCCN2)c(O)c1 |
| InChI | InChI=1S/C11H14N2O/c1-8-3-4-9(10(14)7-8)11-12-5-2-6-13-11/h3-4,7,14H,2,5-6H2,1H3,(H,12,13) |
| InChIKey | DKNUUSRDJALTFY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |