C9H10N2O2 — CID 4583261
4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol (PubChem CID 4583261) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol.
| Compound Name | 4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 4583261 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol |
| SMILES | Oc1ccc(C2=NCCN2)c(O)c1 |
| InChI | InChI=1S/C9H10N2O2/c12-6-1-2-7(8(13)5-6)9-10-3-4-11-9/h1-2,5,12-13H,3-4H2,(H,10,11) |
| InChIKey | GFNPELRHYAMVCB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |