About 4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol
4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol (PubChem CID 4583261) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol |
| PubChem CID | 4583261 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol |
| SMILES | Oc1ccc(C2=NCCN2)c(O)c1 |
| InChI | InChI=1S/C9H10N2O2/c12-6-1-2-7(8(13)5-6)9-10-3-4-11-9/h1-2,5,12-13H,3-4H2,(H,10,11) |
| InChIKey | GFNPELRHYAMVCB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol?
The IUPAC name of 4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol (CID 4583261) is 4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol.
What is the SMILES notation for 4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol?
The canonical SMILES for 4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol is Oc1ccc(C2=NCCN2)c(O)c1.
What is the InChIKey of 4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol?
The InChIKey is GFNPELRHYAMVCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c12-6-1-2-7(8(13)5-6)9-10-3-4-11-9/h1-2,5,12-13H,3-4H2,(H,10,11).
What are the key properties of 4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol?
4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol has a molecular weight of 178.19 g/mol, XLogP of 0.45, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diol is sourced from PubChem (CID 4583261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).