C10H11BF4N- — CID 174929053
1-methyl-3,4-dihydroisoquinoline tetrafluoroborate (PubChem CID 174929053) has the molecular formula C10H11BF4N- and a molecular weight of 232.01 g/mol. Its IUPAC name is 1-methyl-3,4-dihydroisoquinoline tetrafluoroborate.
| Compound Name | 1-methyl-3,4-dihydroisoquinoline tetrafluoroborate |
|---|---|
| PubChem CID | 174929053 |
| Molecular Formula | C10H11BF4N- |
| Molecular Weight | 232.01 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 1-methyl-3,4-dihydroisoquinoline tetrafluoroborate |
| SMILES | CC1=NCCc2ccccc21.F[B-](F)(F)F |
| InChI | InChI=1S/C10H11N.BF4/c1-8-10-5-3-2-4-9(10)6-7-11-8;2-1(3,4)5/h2-5H,6-7H2,1H3;/q;-1 |
| InChIKey | AZVSQBTVMQTHEK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.01 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|