C12H13N — CID 175704614
1-prop-1-en-2-yl-3,4-dihydroisoquinoline (PubChem CID 175704614) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 1-prop-1-en-2-yl-3,4-dihydroisoquinoline.
| Compound Name | 1-prop-1-en-2-yl-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 175704614 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 1-prop-1-en-2-yl-3,4-dihydroisoquinoline |
| SMILES | C=C(C)C1=NCCc2ccccc21 |
| InChI | InChI=1S/C12H13N/c1-9(2)12-11-6-4-3-5-10(11)7-8-13-12/h3-6H,1,7-8H2,2H3 |
| InChIKey | RBQZNKWHQSLIQE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |