C11H13ClN2O — CID 135478442
(NZ)-N-[1-(3,4-dihydroisoquinolin-1-yl)ethylidene]hydroxylamine;hydrochloride (PubChem CID 135478442) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is (NZ)-N-[1-(3,4-dihydroisoquinolin-1-yl)ethylidene]hydroxylamine;hydrochloride.
| Compound Name | (NZ)-N-[1-(3,4-dihydroisoquinolin-1-yl)ethylidene]hydroxylamine;hydrochloride |
|---|---|
| PubChem CID | 135478442 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | (NZ)-N-[1-(3,4-dihydroisoquinolin-1-yl)ethylidene]hydroxylamine;hydrochloride |
| SMILES | C/C(=N/O)C1=NCCc2ccccc21.Cl |
| InChI | InChI=1S/C11H12N2O.ClH/c1-8(13-14)11-10-5-3-2-4-9(10)6-7-12-11;/h2-5,14H,6-7H2,1H3;1H/b13-8-; |
| InChIKey | XMKKBAXUBCKFTH-MGAWDJABSA-N |
| XLogP | 2.30 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|