About 3-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]-N,N-diethylpropanamide
3-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]-N,N-diethylpropanamide (PubChem CID 81321990) has the molecular formula C16H23ClN2O
and a molecular weight of 294.83 g/mol. Its IUPAC name is 3-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 3-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]-N,N-diethylpropanamide |
| PubChem CID | 81321990 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 3-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNC1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H23ClN2O/c1-3-19(4-2)16(20)9-10-18-15-8-5-12-11-13(17)6-7-14(12)15/h6-7,11,15,18H,3-5,8-10H2,1-2H3 |
| InChIKey | QFFZHTPUWGRUFG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]-N,N-diethylpropanamide?
The IUPAC name of 3-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]-N,N-diethylpropanamide (CID 81321990) is 3-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]-N,N-diethylpropanamide.
What is the SMILES notation for 3-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]-N,N-diethylpropanamide?
The canonical SMILES for 3-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]-N,N-diethylpropanamide is CCN(CC)C(=O)CCNC1CCc2cc(Cl)ccc21.
What is the InChIKey of 3-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]-N,N-diethylpropanamide?
The InChIKey is QFFZHTPUWGRUFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23ClN2O/c1-3-19(4-2)16(20)9-10-18-15-8-5-12-11-13(17)6-7-14(12)15/h6-7,11,15,18H,3-5,8-10H2,1-2H3.
What are the key properties of 3-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]-N,N-diethylpropanamide?
3-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]-N,N-diethylpropanamide has a molecular weight of 294.83 g/mol, XLogP of 3.18, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-chloro-2,3-dihydro-1H-inden-1-yl)amino]-N,N-diethylpropanamide is sourced from PubChem (CID 81321990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).