C15H12ClNO — CID 143166068
6-chloro-16-azatricyclo[9.5.0.03,8]hexadeca-1(11),3(8),4,6,13,15-hexaen-2-one (PubChem CID 143166068) has the molecular formula C15H12ClNO and a molecular weight of 257.72 g/mol. Its IUPAC name is 6-chloro-16-azatricyclo[9.5.0.03,8]hexadeca-1(11),3(8),4,6,13,15-hexaen-2-one.
| Compound Name | 6-chloro-16-azatricyclo[9.5.0.03,8]hexadeca-1(11),3(8),4,6,13,15-hexaen-2-one |
|---|---|
| PubChem CID | 143166068 |
| Molecular Formula | C15H12ClNO |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 6-chloro-16-azatricyclo[9.5.0.03,8]hexadeca-1(11),3(8),4,6,13,15-hexaen-2-one |
| SMILES | O=C1C2=C(CC=CC=N2)CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H12ClNO/c16-12-6-7-13-11(9-12)5-4-10-3-1-2-8-17-14(10)15(13)18/h1-2,6-9H,3-5H2 |
| InChIKey | IAKLVWVDYUWRGW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |